C14H22O4 — CID 11817654
(E,2R)-2-[(2R)-oxiran-2-yl]-4-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]but-3-en-2-ol (PubChem CID 11817654) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is (E,2R)-2-[(2R)-oxiran-2-yl]-4-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]but-3-en-2-ol.
| Compound Name | (E,2R)-2-[(2R)-oxiran-2-yl]-4-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]but-3-en-2-ol |
|---|---|
| PubChem CID | 11817654 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (E,2R)-2-[(2R)-oxiran-2-yl]-4-[(2R,6R)-6-propan-2-yloxy-3,6-dihydro-2H-pyran-2-yl]but-3-en-2-ol |
| SMILES | CC(C)O[C@H]1C=CC[C@H](/C=C/[C@@](C)(O)[C@H]2CO2)O1 |
| InChI | InChI=1S/C14H22O4/c1-10(2)17-13-6-4-5-11(18-13)7-8-14(3,15)12-9-16-12/h4,6-8,10-13,15H,5,9H2,1-3H3/b8-7+/t11-,12-,13-,14-/m1/s1 |
| InChIKey | MQMSNLXEPGPLKS-SDUGENJDSA-N |
| XLogP | 1.79 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|