C8H13IO3 — CID 11346632
(2S,3S,6S)-2-(iodomethyl)-6-methoxy-3-methyl-2,6-dihydropyran-3-ol (PubChem CID 11346632) has the molecular formula C8H13IO3 and a molecular weight of 284.09 g/mol. Its IUPAC name is (2S,3S,6S)-2-(iodomethyl)-6-methoxy-3-methyl-2,6-dihydropyran-3-ol.
| Compound Name | (2S,3S,6S)-2-(iodomethyl)-6-methoxy-3-methyl-2,6-dihydropyran-3-ol |
|---|---|
| PubChem CID | 11346632 |
| Molecular Formula | C8H13IO3 |
| Molecular Weight | 284.09 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | (2S,3S,6S)-2-(iodomethyl)-6-methoxy-3-methyl-2,6-dihydropyran-3-ol |
| SMILES | CO[C@@H]1C=C[C@](C)(O)[C@@H](CI)O1 |
| InChI | InChI=1S/C8H13IO3/c1-8(10)4-3-7(11-2)12-6(8)5-9/h3-4,6-7,10H,5H2,1-2H3/t6-,7+,8+/m1/s1 |
| InChIKey | VZMHUFPIBRIUEZ-CSMHCCOUSA-N |
| XLogP | 1.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.09 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|