C9H14O3 — CID 85247166
2-methyl-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-ol (PubChem CID 85247166) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-methyl-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | 2-methyl-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 85247166 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-methyl-6-prop-2-enoxy-3,6-dihydro-2H-pyran-3-ol |
| SMILES | C=CCOC1C=CC(O)C(C)O1 |
| InChI | InChI=1S/C9H14O3/c1-3-6-11-9-5-4-8(10)7(2)12-9/h3-5,7-10H,1,6H2,2H3 |
| InChIKey | KINSZGJFBIHORT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|