C17H20O2 — CID 11817715
(3S)-3-methoxy-3,4-diphenylbutan-1-ol (PubChem CID 11817715) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is (3S)-3-methoxy-3,4-diphenylbutan-1-ol.
| Compound Name | (3S)-3-methoxy-3,4-diphenylbutan-1-ol |
|---|---|
| PubChem CID | 11817715 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (3S)-3-methoxy-3,4-diphenylbutan-1-ol |
| SMILES | CO[C@](CCO)(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-19-17(12-13-18,16-10-6-3-7-11-16)14-15-8-4-2-5-9-15/h2-11,18H,12-14H2,1H3/t17-/m1/s1 |
| InChIKey | VPYNAULRRFPEDJ-QGZVFWFLSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |