C24H26O4 — CID 67817845
3-methoxy-4,5,5-triphenylpentane-1,3,4-triol (PubChem CID 67817845) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 3-methoxy-4,5,5-triphenylpentane-1,3,4-triol.
| Compound Name | 3-methoxy-4,5,5-triphenylpentane-1,3,4-triol |
|---|---|
| PubChem CID | 67817845 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-methoxy-4,5,5-triphenylpentane-1,3,4-triol |
| SMILES | COC(O)(CCO)C(O)(c1ccccc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26O4/c1-28-23(26,17-18-25)24(27,21-15-9-4-10-16-21)22(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-16,22,25-27H,17-18H2,1H3 |
| InChIKey | KLFDAYHCZJEQBZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|