C17H26O7 — CID 118177822
[3,3-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxopropyl] 2-methylprop-2-enoate (PubChem CID 118177822) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [3,3-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3,3-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118177822 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [3,3-bis(2,2-dimethyl-1,3-dioxolan-4-yl)-2-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)C(C1COC(C)(C)O1)C1COC(C)(C)O1 |
| InChI | InChI=1S/C17H26O7/c1-10(2)15(19)20-7-11(18)14(12-8-21-16(3,4)23-12)13-9-22-17(5,6)24-13/h12-14H,1,7-9H2,2-6H3 |
| InChIKey | DCDSPCWIMWEJHZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|