C23H21NO7 — CID 118178552
methyl 4-acetyloxy-1-(acetyloxymethyl)-7-(4-methylphenoxy)isoquinoline-3-carboxylate (PubChem CID 118178552) has the molecular formula C23H21NO7 and a molecular weight of 423.42 g/mol. Its IUPAC name is methyl 4-acetyloxy-1-(acetyloxymethyl)-7-(4-methylphenoxy)isoquinoline-3-carboxylate.
| Compound Name | methyl 4-acetyloxy-1-(acetyloxymethyl)-7-(4-methylphenoxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 118178552 |
| Molecular Formula | C23H21NO7 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | methyl 4-acetyloxy-1-(acetyloxymethyl)-7-(4-methylphenoxy)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1nc(COC(C)=O)c2cc(Oc3ccc(C)cc3)ccc2c1OC(C)=O |
| InChI | InChI=1S/C23H21NO7/c1-13-5-7-16(8-6-13)31-17-9-10-18-19(11-17)20(12-29-14(2)25)24-21(23(27)28-4)22(18)30-15(3)26/h5-11H,12H2,1-4H3 |
| InChIKey | GANXOFYSYPVORE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |