C20H17NO7 — CID 145356405
methyl 1-(acetyloxymethyl)-4-hydroxy-7-(3-hydroxyphenoxy)isoquinoline-3-carboxylate (PubChem CID 145356405) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is methyl 1-(acetyloxymethyl)-4-hydroxy-7-(3-hydroxyphenoxy)isoquinoline-3-carboxylate.
| Compound Name | methyl 1-(acetyloxymethyl)-4-hydroxy-7-(3-hydroxyphenoxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 145356405 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | methyl 1-(acetyloxymethyl)-4-hydroxy-7-(3-hydroxyphenoxy)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1nc(COC(C)=O)c2cc(Oc3cccc(O)c3)ccc2c1O |
| InChI | InChI=1S/C20H17NO7/c1-11(22)27-10-17-16-9-14(28-13-5-3-4-12(23)8-13)6-7-15(16)19(24)18(21-17)20(25)26-2/h3-9,23-24H,10H2,1-2H3 |
| InChIKey | CPEBLVYZAQOCNO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |