C23H21NO8 — CID 118181185
methyl 4-acetyloxy-1-(acetyloxymethyl)-6-(4-methoxyphenoxy)isoquinoline-3-carboxylate (PubChem CID 118181185) has the molecular formula C23H21NO8 and a molecular weight of 439.42 g/mol. Its IUPAC name is methyl 4-acetyloxy-1-(acetyloxymethyl)-6-(4-methoxyphenoxy)isoquinoline-3-carboxylate.
| Compound Name | methyl 4-acetyloxy-1-(acetyloxymethyl)-6-(4-methoxyphenoxy)isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 118181185 |
| Molecular Formula | C23H21NO8 |
| Molecular Weight | 439.42 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | methyl 4-acetyloxy-1-(acetyloxymethyl)-6-(4-methoxyphenoxy)isoquinoline-3-carboxylate |
| SMILES | COC(=O)c1nc(COC(C)=O)c2ccc(Oc3ccc(OC)cc3)cc2c1OC(C)=O |
| InChI | InChI=1S/C23H21NO8/c1-13(25)30-12-20-18-10-9-17(32-16-7-5-15(28-3)6-8-16)11-19(18)22(31-14(2)26)21(24-20)23(27)29-4/h5-11H,12H2,1-4H3 |
| InChIKey | XVMPNLKWSQQURI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 110.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |