C9H16N2 — CID 118178666
(3S,6S)-1-ethyl-6-methylpiperidine-3-carbonitrile (PubChem CID 118178666) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3S,6S)-1-ethyl-6-methylpiperidine-3-carbonitrile.
| Compound Name | (3S,6S)-1-ethyl-6-methylpiperidine-3-carbonitrile |
|---|---|
| PubChem CID | 118178666 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (3S,6S)-1-ethyl-6-methylpiperidine-3-carbonitrile |
| SMILES | CCN1C[C@@H](C#N)CC[C@@H]1C |
| InChI | InChI=1S/C9H16N2/c1-3-11-7-9(6-10)5-4-8(11)2/h8-9H,3-5,7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | KBQHGCVGJVGUOP-DTWKUNHWSA-N |
| XLogP | 1.63 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |