C11H20N2 — CID 130727541
1-ethyl-2,5-dimethyl-4-prop-2-ynylpiperazine (PubChem CID 130727541) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-ethyl-2,5-dimethyl-4-prop-2-ynylpiperazine.
| Compound Name | 1-ethyl-2,5-dimethyl-4-prop-2-ynylpiperazine |
|---|---|
| PubChem CID | 130727541 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-ethyl-2,5-dimethyl-4-prop-2-ynylpiperazine |
| SMILES | C#CCN1CC(C)N(CC)CC1C |
| InChI | InChI=1S/C11H20N2/c1-5-7-13-9-10(3)12(6-2)8-11(13)4/h1,10-11H,6-9H2,2-4H3 |
| InChIKey | ZGLUPWMWQLWQRJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|