C14H26NO4P — CID 29111881
(2S,4S,5S)-4-diethoxyphosphoryl-2,5-dimethyl-1-prop-2-ynylpiperidin-4-ol (PubChem CID 29111881) has the molecular formula C14H26NO4P and a molecular weight of 303.34 g/mol. Its IUPAC name is (2S,4S,5S)-4-diethoxyphosphoryl-2,5-dimethyl-1-prop-2-ynylpiperidin-4-ol.
| Compound Name | (2S,4S,5S)-4-diethoxyphosphoryl-2,5-dimethyl-1-prop-2-ynylpiperidin-4-ol |
|---|---|
| PubChem CID | 29111881 |
| Molecular Formula | C14H26NO4P |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2S,4S,5S)-4-diethoxyphosphoryl-2,5-dimethyl-1-prop-2-ynylpiperidin-4-ol |
| SMILES | C#CCN1C[C@H](C)[C@@](O)(P(=O)(OCC)OCC)C[C@@H]1C |
| InChI | InChI=1S/C14H26NO4P/c1-6-9-15-11-12(4)14(16,10-13(15)5)20(17,18-7-2)19-8-3/h1,12-13,16H,7-11H2,2-5H3/t12-,13-,14-/m0/s1 |
| InChIKey | YQHKTBCGKFOUQO-IHRRRGAJSA-N |
| XLogP | 2.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|