C14H18O5 — CID 11817970
(1S,5S,6R)-1-[(E)-hex-4-enoyl]-4,5-dihydroxy-3,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 11817970) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (1S,5S,6R)-1-[(E)-hex-4-enoyl]-4,5-dihydroxy-3,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5S,6R)-1-[(E)-hex-4-enoyl]-4,5-dihydroxy-3,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 11817970 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (1S,5S,6R)-1-[(E)-hex-4-enoyl]-4,5-dihydroxy-3,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | C/C=C/CCC(=O)[C@@]12O[C@@H]1[C@](C)(O)C(O)=C(C)C2=O |
| InChI | InChI=1S/C14H18O5/c1-4-5-6-7-9(15)14-11(17)8(2)10(16)13(3,18)12(14)19-14/h4-5,12,16,18H,6-7H2,1-3H3/b5-4+/t12-,13-,14+/m1/s1 |
| InChIKey | DKCUQULQOYTPMC-KMOUYIMBSA-N |
| XLogP | 1.22 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|