C12H7F3N2S — CID 11818011
1-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyrazole (PubChem CID 11818011) has the molecular formula C12H7F3N2S and a molecular weight of 268.26 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyrazole.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyrazole |
|---|---|
| PubChem CID | 11818011 |
| Molecular Formula | C12H7F3N2S |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]thieno[2,3-d]pyrazole |
| SMILES | FC(F)(F)c1ccc(-n2ncc3sccc32)cc1 |
| InChI | InChI=1S/C12H7F3N2S/c13-12(14,15)8-1-3-9(4-2-8)17-10-5-6-18-11(10)7-16-17/h1-7H |
| InChIKey | HPJJUKOZJCTATA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |