C27H25ClN4O2S — CID 118182366
2-chloro-4-[4,4-dimethyl-5-oxo-3-[3-(4-pyridin-3-ylphenoxy)propyl]-2-sulfanylideneimidazolidin-1-yl]-3-methylbenzonitrile (PubChem CID 118182366) has the molecular formula C27H25ClN4O2S and a molecular weight of 505.04 g/mol. Its IUPAC name is 2-chloro-4-[4,4-dimethyl-5-oxo-3-[3-(4-pyridin-3-ylphenoxy)propyl]-2-sulfanylideneimidazolidin-1-yl]-3-methylbenzonitrile.
| Compound Name | 2-chloro-4-[4,4-dimethyl-5-oxo-3-[3-(4-pyridin-3-ylphenoxy)propyl]-2-sulfanylideneimidazolidin-1-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 118182366 |
| Molecular Formula | C27H25ClN4O2S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 2-chloro-4-[4,4-dimethyl-5-oxo-3-[3-(4-pyridin-3-ylphenoxy)propyl]-2-sulfanylideneimidazolidin-1-yl]-3-methylbenzonitrile |
| SMILES | Cc1c(N2C(=O)C(C)(C)N(CCCOc3ccc(-c4cccnc4)cc3)C2=S)ccc(C#N)c1Cl |
| InChI | InChI=1S/C27H25ClN4O2S/c1-18-23(12-9-20(16-29)24(18)28)32-25(33)27(2,3)31(26(32)35)14-5-15-34-22-10-7-19(8-11-22)21-6-4-13-30-17-21/h4,6-13,17H,5,14-15H2,1-3H3 |
| InChIKey | BHSVAFBXJDBXGK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|