C33H37NO6 — CID 118183372
1-[1-(3-butoxy-6,7-dimethoxyphenanthren-9-yl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]ethanone (PubChem CID 118183372) has the molecular formula C33H37NO6 and a molecular weight of 543.66 g/mol. Its IUPAC name is 1-[1-(3-butoxy-6,7-dimethoxyphenanthren-9-yl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]ethanone.
| Compound Name | 1-[1-(3-butoxy-6,7-dimethoxyphenanthren-9-yl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
|---|---|
| PubChem CID | 118183372 |
| Molecular Formula | C33H37NO6 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | 1-[1-(3-butoxy-6,7-dimethoxyphenanthren-9-yl)-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl]ethanone |
| SMILES | CCCCOc1ccc2cc(C3c4cc(OC)c(OC)cc4CCN3C(C)=O)c3cc(OC)c(OC)cc3c2c1 |
| InChI | InChI=1S/C33H37NO6/c1-7-8-13-40-23-10-9-21-14-28(27-19-32(39-6)31(38-5)18-26(27)24(21)16-23)33-25-17-30(37-4)29(36-3)15-22(25)11-12-34(33)20(2)35/h9-10,14-19,33H,7-8,11-13H2,1-6H3 |
| InChIKey | KHMHVHZDTQUBPO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|