C37H38N2O7 — CID 174758183
2-amino-1-[6,7-dimethoxy-1-(3,6,7-trimethoxyphenanthren-9-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4-hydroxyphenyl)propan-1-one (PubChem CID 174758183) has the molecular formula C37H38N2O7 and a molecular weight of 622.72 g/mol. Its IUPAC name is 2-amino-1-[6,7-dimethoxy-1-(3,6,7-trimethoxyphenanthren-9-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4-hydroxyphenyl)propan-1-one.
| Compound Name | 2-amino-1-[6,7-dimethoxy-1-(3,6,7-trimethoxyphenanthren-9-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 174758183 |
| Molecular Formula | C37H38N2O7 |
| Molecular Weight | 622.72 g/mol |
| Exact Mass | 622.27 |
| IUPAC Name | 2-amino-1-[6,7-dimethoxy-1-(3,6,7-trimethoxyphenanthren-9-yl)-3,4-dihydro-1H-isoquinolin-2-yl]-3-(4-hydroxyphenyl)propan-1-one |
| SMILES | COc1ccc2cc(C3c4cc(OC)c(OC)cc4CCN3C(=O)C(N)Cc3ccc(O)cc3)c3cc(OC)c(OC)cc3c2c1 |
| InChI | InChI=1S/C37H38N2O7/c1-42-25-11-8-22-15-30(29-20-35(46-5)34(45-4)19-28(29)26(22)17-25)36-27-18-33(44-3)32(43-2)16-23(27)12-13-39(36)37(41)31(38)14-21-6-9-24(40)10-7-21/h6-11,15-20,31,36,40H,12-14,38H2,1-5H3 |
| InChIKey | PPJPFMFFBYSAND-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.72 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|