C34H41N3O6 — CID 174758134
(2S)-2,6-diamino-1-[(1R)-6,7-dimethoxy-1-(3,6,7-trimethoxyphenanthren-9-yl)-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one (PubChem CID 174758134) has the molecular formula C34H41N3O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is (2S)-2,6-diamino-1-[(1R)-6,7-dimethoxy-1-(3,6,7-trimethoxyphenanthren-9-yl)-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one.
| Compound Name | (2S)-2,6-diamino-1-[(1R)-6,7-dimethoxy-1-(3,6,7-trimethoxyphenanthren-9-yl)-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one |
|---|---|
| PubChem CID | 174758134 |
| Molecular Formula | C34H41N3O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | (2S)-2,6-diamino-1-[(1R)-6,7-dimethoxy-1-(3,6,7-trimethoxyphenanthren-9-yl)-3,4-dihydro-1H-isoquinolin-2-yl]hexan-1-one |
| SMILES | COc1ccc2cc([C@H]3c4cc(OC)c(OC)cc4CCN3C(=O)[C@@H](N)CCCCN)c3cc(OC)c(OC)cc3c2c1 |
| InChI | InChI=1S/C34H41N3O6/c1-39-22-10-9-20-14-27(26-19-32(43-5)31(42-4)18-25(26)23(20)16-22)33-24-17-30(41-3)29(40-2)15-21(24)11-13-37(33)34(38)28(36)8-6-7-12-35/h9-10,14-19,28,33H,6-8,11-13,35-36H2,1-5H3/t28-,33+/m0/s1 |
| InChIKey | NWRIXQFCZIOVOU-QPQHGXMVSA-N |
| XLogP | 4.97 |
| TPSA | 118.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|