About 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid
6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 118190062) has the molecular formula C7H8FNO2
and a molecular weight of 157.14 g/mol. Its IUPAC name is 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid.
Analyze 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid (CID 118190062) is 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid is NC1=CCCC(F)=C1C(=O)O.
What is the InChIKey of 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is SVGHTJZPCIISPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO2/c8-4-2-1-3-5(9)6(4)7(10)11/h3H,1-2,9H2,(H,10,11).
What are the key properties of 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid?
6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 157.14 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-fluorocyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 118190062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).