7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid

C8H8FNO2 — CID 156547400

IUPAC7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid
SMILESNC1=CC=C(F)CC=C1C(=O)O
InChIInChI=1S/C8H8FNO2/c9-5-1-3-6(8(11)12)7(10)4-2-5/h2-4H,1,10H2,(H,11,12)
InChIKeyKWXAOHKFEMMRII-UHFFFAOYSA-N
MW169.16 g/mol
LogP1.10
Rot. Bonds1

About 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid

7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid (PubChem CID 156547400) has the molecular formula C8H8FNO2 and a molecular weight of 169.16 g/mol. Its IUPAC name is 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid.

Molecular Properties

Compound Name7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid
PubChem CID156547400
Molecular FormulaC8H8FNO2
Molecular Weight169.16 g/mol
Exact Mass169.05
IUPAC Name7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid
SMILESNC1=CC=C(F)CC=C1C(=O)O
InChIInChI=1S/C8H8FNO2/c9-5-1-3-6(8(11)12)7(10)4-2-5/h2-4H,1,10H2,(H,11,12)
InChIKeyKWXAOHKFEMMRII-UHFFFAOYSA-N
XLogP1.10
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.16
LogP ≤ 51.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid?
The IUPAC name of 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid (CID 156547400) is 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid.
What is the SMILES notation for 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid?
The canonical SMILES for 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid is NC1=CC=C(F)CC=C1C(=O)O.
What is the InChIKey of 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid?
The InChIKey is KWXAOHKFEMMRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FNO2/c9-5-1-3-6(8(11)12)7(10)4-2-5/h2-4H,1,10H2,(H,11,12).
What are the key properties of 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid?
7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid has a molecular weight of 169.16 g/mol, XLogP of 1.10, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4-fluorocyclohepta-1,4,6-triene-1-carboxylic acid is sourced from PubChem (CID 156547400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).