C8H5F3N4OS2 — CID 118190648
5-sulfanylidene-2-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-1,2,4-triazin-3-one (PubChem CID 118190648) has the molecular formula C8H5F3N4OS2 and a molecular weight of 294.28 g/mol. Its IUPAC name is 5-sulfanylidene-2-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-1,2,4-triazin-3-one.
| Compound Name | 5-sulfanylidene-2-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 118190648 |
| Molecular Formula | C8H5F3N4OS2 |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 5-sulfanylidene-2-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]-1,2,4-triazin-3-one |
| SMILES | O=c1[nH]c(=S)cnn1Cc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H5F3N4OS2/c9-8(10,11)6-12-1-4(18-6)3-15-7(16)14-5(17)2-13-15/h1-2H,3H2,(H,14,16,17) |
| InChIKey | AFHROJHNCXRCBS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|