C7H7F3N4OS — CID 174738730
1-(aminomethylidene)-3-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]urea (PubChem CID 174738730) has the molecular formula C7H7F3N4OS and a molecular weight of 252.22 g/mol. Its IUPAC name is 1-(aminomethylidene)-3-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]urea.
| Compound Name | 1-(aminomethylidene)-3-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]urea |
|---|---|
| PubChem CID | 174738730 |
| Molecular Formula | C7H7F3N4OS |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 1-(aminomethylidene)-3-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methyl]urea |
| SMILES | NC=NC(=O)NCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C7H7F3N4OS/c8-7(9,10)5-12-1-4(16-5)2-13-6(15)14-3-11/h1,3H,2H2,(H3,11,13,14,15) |
| InChIKey | BQJMDLFWRHNVSL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|