C7H6F3N4OS2- — CID 162542761
N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate (PubChem CID 162542761) has the molecular formula C7H6F3N4OS2- and a molecular weight of 283.28 g/mol. Its IUPAC name is N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate.
| Compound Name | N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate |
|---|---|
| PubChem CID | 162542761 |
| Molecular Formula | C7H6F3N4OS2- |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | N'-[[2-(trifluoromethyl)-1,3-thiazol-5-yl]methylcarbamoyl]carbamimidothioate |
| SMILES | N/C([S-])=N/C(=O)NCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C7H7F3N4OS2/c8-7(9,10)4-12-1-3(17-4)2-13-6(15)14-5(11)16/h1H,2H2,(H4,11,13,14,15,16)/p-1 |
| InChIKey | BDQLPVSRIGVDBO-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|