C22H21F3N4O3 — CID 118195381
6-(3-hydroxypropylamino)-5-(6-methyl-3-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 118195381) has the molecular formula C22H21F3N4O3 and a molecular weight of 446.43 g/mol. Its IUPAC name is 6-(3-hydroxypropylamino)-5-(6-methyl-3-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-(3-hydroxypropylamino)-5-(6-methyl-3-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118195381 |
| Molecular Formula | C22H21F3N4O3 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 6-(3-hydroxypropylamino)-5-(6-methyl-3-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3ccc(OC(F)(F)F)cc3)cnc2NCCCO)cn1 |
| InChI | InChI=1S/C22H21F3N4O3/c1-14-3-4-15(12-27-14)19-11-16(13-28-20(19)26-9-2-10-30)21(31)29-17-5-7-18(8-6-17)32-22(23,24)25/h3-8,11-13,30H,2,9-10H2,1H3,(H,26,28)(H,29,31) |
| InChIKey | FXDMWIMUKCLGKZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|