C23H23F3N4O2 — CID 118919387
6-(butylamino)-5-(6-methyl-3-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 118919387) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is 6-(butylamino)-5-(6-methyl-3-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 6-(butylamino)-5-(6-methyl-3-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118919387 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 6-(butylamino)-5-(6-methyl-3-pyridinyl)-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | CCCCNc1ncc(C(=O)Nc2ccc(OC(F)(F)F)cc2)cc1-c1ccc(C)nc1 |
| InChI | InChI=1S/C23H23F3N4O2/c1-3-4-11-27-21-20(16-6-5-15(2)28-13-16)12-17(14-29-21)22(31)30-18-7-9-19(10-8-18)32-23(24,25)26/h5-10,12-14H,3-4,11H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | UFCPOVOMJMVRFJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|