C13H7N3O2S — CID 118198065
13-nitro-8-thia-2,3-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,7(11),9,13,15-heptaene (PubChem CID 118198065) has the molecular formula C13H7N3O2S and a molecular weight of 269.29 g/mol. Its IUPAC name is 13-nitro-8-thia-2,3-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,7(11),9,13,15-heptaene.
| Compound Name | 13-nitro-8-thia-2,3-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,7(11),9,13,15-heptaene |
|---|---|
| PubChem CID | 118198065 |
| Molecular Formula | C13H7N3O2S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.03 |
| IUPAC Name | 13-nitro-8-thia-2,3-diazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),3,5,7(11),9,13,15-heptaene |
| SMILES | O=[N+]([O-])c1cccc2c1c1ccsc1c1ccnn12 |
| InChI | InChI=1S/C13H7N3O2S/c17-16(18)10-3-1-2-9-12(10)8-5-7-19-13(8)11-4-6-14-15(9)11/h1-7H |
| InChIKey | ACMBKPGNTZECCN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|