C12H13NO2 — CID 11820192
5-ethenyl-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 11820192) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-ethenyl-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-ethenyl-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 11820192 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-ethenyl-3-(2-methoxyphenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | C=CC1CC(c2ccccc2OC)=NO1 |
| InChI | InChI=1S/C12H13NO2/c1-3-9-8-11(13-15-9)10-6-4-5-7-12(10)14-2/h3-7,9H,1,8H2,2H3 |
| InChIKey | CVKMLNFOJREBDQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|