C21H35NO13 — CID 118203048
[2,3,6-tris(ethoxycarbonyloxy)-5-hydroxy-4-methoxycyclohexyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 118203048) has the molecular formula C21H35NO13 and a molecular weight of 509.51 g/mol. Its IUPAC name is [2,3,6-tris(ethoxycarbonyloxy)-5-hydroxy-4-methoxycyclohexyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [2,3,6-tris(ethoxycarbonyloxy)-5-hydroxy-4-methoxycyclohexyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 118203048 |
| Molecular Formula | C21H35NO13 |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | [2,3,6-tris(ethoxycarbonyloxy)-5-hydroxy-4-methoxycyclohexyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CCOC(=O)OC1C(O)C(OC)C(OC(=O)OCC)C(OC(=O)OCC)C1OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C21H35NO13/c1-7-29-19(25)33-14-12(23)13(28-6)15(34-20(26)30-8-2)17(35-21(27)31-9-3)16(14)32-18(24)11(22)10(4)5/h10-17,23H,7-9,22H2,1-6H3/t11-,12?,13?,14?,15?,16?,17?/m0/s1 |
| InChIKey | QXQBERPMRRBLFZ-GSOTZPCNSA-N |
| XLogP | 0.90 |
| TPSA | 188.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|