C22H34O16 — CID 118203008
ethyl [2,3,4,5-tetrakis(ethoxycarbonyloxy)-6-methoxycyclohexyl] carbonate (PubChem CID 118203008) has the molecular formula C22H34O16 and a molecular weight of 554.50 g/mol. Its IUPAC name is ethyl [2,3,4,5-tetrakis(ethoxycarbonyloxy)-6-methoxycyclohexyl] carbonate.
| Compound Name | ethyl [2,3,4,5-tetrakis(ethoxycarbonyloxy)-6-methoxycyclohexyl] carbonate |
|---|---|
| PubChem CID | 118203008 |
| Molecular Formula | C22H34O16 |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | ethyl [2,3,4,5-tetrakis(ethoxycarbonyloxy)-6-methoxycyclohexyl] carbonate |
| SMILES | CCOC(=O)OC1C(OC)C(OC(=O)OCC)C(OC(=O)OCC)C(OC(=O)OCC)C1OC(=O)OCC |
| InChI | InChI=1S/C22H34O16/c1-7-29-18(23)34-13-12(28-6)14(35-19(24)30-8-2)16(37-21(26)32-10-4)17(38-22(27)33-11-5)15(13)36-20(25)31-9-3/h12-17H,7-11H2,1-6H3 |
| InChIKey | MAHJGRKVZCBJPQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 186.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|