C17H28O9 — CID 101247633
[(2R,3R,4S,5R,6S)-2-but-3-enyl-5-ethoxycarbonyloxy-4,6-dimethoxyoxan-3-yl] ethyl carbonate (PubChem CID 101247633) has the molecular formula C17H28O9 and a molecular weight of 376.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-2-but-3-enyl-5-ethoxycarbonyloxy-4,6-dimethoxyoxan-3-yl] ethyl carbonate.
| Compound Name | [(2R,3R,4S,5R,6S)-2-but-3-enyl-5-ethoxycarbonyloxy-4,6-dimethoxyoxan-3-yl] ethyl carbonate |
|---|---|
| PubChem CID | 101247633 |
| Molecular Formula | C17H28O9 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-2-but-3-enyl-5-ethoxycarbonyloxy-4,6-dimethoxyoxan-3-yl] ethyl carbonate |
| SMILES | C=CCC[C@H]1O[C@H](OC)[C@H](OC(=O)OCC)[C@@H](OC)[C@@H]1OC(=O)OCC |
| InChI | InChI=1S/C17H28O9/c1-6-9-10-11-12(25-16(18)22-7-2)13(20-4)14(15(21-5)24-11)26-17(19)23-8-3/h6,11-15H,1,7-10H2,2-5H3/t11-,12-,13+,14-,15+/m1/s1 |
| InChIKey | JNOOQIBANFBFRH-QMIVOQANSA-N |
| XLogP | 2.42 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|