C15H22O9 — CID 139805859
ethyl 3-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]propanoate (PubChem CID 139805859) has the molecular formula C15H22O9 and a molecular weight of 346.33 g/mol. Its IUPAC name is ethyl 3-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]propanoate.
| Compound Name | ethyl 3-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]propanoate |
|---|---|
| PubChem CID | 139805859 |
| Molecular Formula | C15H22O9 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | ethyl 3-[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxolan-2-yl]propanoate |
| SMILES | CCOC(=O)CC[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H22O9/c1-5-20-12(19)7-6-11-13(21-8(2)16)14(22-9(3)17)15(24-11)23-10(4)18/h11,13-15H,5-7H2,1-4H3/t11-,13-,14-,15-/m1/s1 |
| InChIKey | CENHXIOIGVFIAP-NMFUWQPSSA-N |
| XLogP | 0.48 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|