C9H14N2O — CID 118203083
trans-(1R,5R)-2-imidazol-1-yl-5-methylcyclopentan-1-ol (PubChem CID 118203083) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is trans-(1R,5R)-2-imidazol-1-yl-5-methylcyclopentan-1-ol.
| Compound Name | trans-(1R,5R)-2-imidazol-1-yl-5-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 118203083 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | trans-(1R,5R)-2-imidazol-1-yl-5-methylcyclopentan-1-ol |
| SMILES | C[C@@H]1CCC(n2ccnc2)[C@@H]1O |
| InChI | InChI=1S/C9H14N2O/c1-7-2-3-8(9(7)12)11-5-4-10-6-11/h4-9,12H,2-3H2,1H3/t7-,8?,9-/m1/s1 |
| InChIKey | ZZOANKWTWISKBP-PSGOWDBMSA-N |
| XLogP | 1.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |