C13H23N2O+ — CID 102090193
trans-(1S,2S)-2-(3-butylimidazol-3-ium-1-yl)cyclohexan-1-ol (PubChem CID 102090193) has the molecular formula C13H23N2O+ and a molecular weight of 223.34 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3-butylimidazol-3-ium-1-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(3-butylimidazol-3-ium-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102090193 |
| Molecular Formula | C13H23N2O+ |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | trans-(1S,2S)-2-(3-butylimidazol-3-ium-1-yl)cyclohexan-1-ol |
| SMILES | CCCC[n+]1ccn([C@H]2CCCC[C@@H]2O)c1 |
| InChI | InChI=1S/C13H23N2O/c1-2-3-8-14-9-10-15(11-14)12-6-4-5-7-13(12)16/h9-13,16H,2-8H2,1H3/q+1/t12-,13-/m0/s1 |
| InChIKey | LEOGGROJIPUPEH-STQMWFEESA-N |
| XLogP | 2.05 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|