About boric acid;1-butyl-3-prop-2-enylimidazol-1-ium
boric acid;1-butyl-3-prop-2-enylimidazol-1-ium (PubChem CID 175194275) has the molecular formula C10H29B4N2O12+
and a molecular weight of 412.59 g/mol. Its IUPAC name is boric acid;1-butyl-3-prop-2-enylimidazol-1-ium.
Molecular Properties
| Compound Name | boric acid;1-butyl-3-prop-2-enylimidazol-1-ium |
| PubChem CID | 175194275 |
| Molecular Formula | C10H29B4N2O12+ |
| Molecular Weight | 412.59 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | boric acid;1-butyl-3-prop-2-enylimidazol-1-ium |
| SMILES | C=CCn1cc[n+](CCCC)c1.OB(O)O.OB(O)O.OB(O)O.OB(O)O |
| InChI | InChI=1S/C10H17N2.4BH3O3/c1-3-5-7-12-9-8-11(10-12)6-4-2;4*2-1(3)4/h4,8-10H,2-3,5-7H2,1H3;4*2-4H/q+1;;;; |
| InChIKey | OLRRSDWTYFSDSD-UHFFFAOYSA-N |
| XLogP | -6.45 |
| TPSA | 251.57 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 412.59 |
| LogP ≤ 5 | -6.45 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze boric acid;1-butyl-3-prop-2-enylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;1-butyl-3-prop-2-enylimidazol-1-ium?
The IUPAC name of boric acid;1-butyl-3-prop-2-enylimidazol-1-ium (CID 175194275) is boric acid;1-butyl-3-prop-2-enylimidazol-1-ium.
What is the SMILES notation for boric acid;1-butyl-3-prop-2-enylimidazol-1-ium?
The canonical SMILES for boric acid;1-butyl-3-prop-2-enylimidazol-1-ium is C=CCn1cc[n+](CCCC)c1.OB(O)O.OB(O)O.OB(O)O.OB(O)O.
What is the InChIKey of boric acid;1-butyl-3-prop-2-enylimidazol-1-ium?
The InChIKey is OLRRSDWTYFSDSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N2.4BH3O3/c1-3-5-7-12-9-8-11(10-12)6-4-2;4*2-1(3)4/h4,8-10H,2-3,5-7H2,1H3;4*2-4H/q+1;;;;.
What are the key properties of boric acid;1-butyl-3-prop-2-enylimidazol-1-ium?
boric acid;1-butyl-3-prop-2-enylimidazol-1-ium has a molecular weight of 412.59 g/mol, XLogP of -6.45, 5 rotatable bonds, 12 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;1-butyl-3-prop-2-enylimidazol-1-ium is sourced from PubChem (CID 175194275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).