C11H14F6N3O4S2+ — CID 101463284
1,1,1-trifluoro-N-[3-(3-prop-2-enylimidazol-1-ium-1-yl)propyl]-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 101463284) has the molecular formula C11H14F6N3O4S2+ and a molecular weight of 430.37 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-(3-prop-2-enylimidazol-1-ium-1-yl)propyl]-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-(3-prop-2-enylimidazol-1-ium-1-yl)propyl]-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 101463284 |
| Molecular Formula | C11H14F6N3O4S2+ |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-(3-prop-2-enylimidazol-1-ium-1-yl)propyl]-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | C=CCn1cc[n+](CCCN(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H14F6N3O4S2/c1-2-4-18-7-8-19(9-18)5-3-6-20(25(21,22)10(12,13)14)26(23,24)11(15,16)17/h2,7-9H,1,3-6H2/q+1 |
| InChIKey | RSWYATOIXZAQRH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|