C16H21ClN2O — CID 139241411
2-(3-benzylimidazol-3-ium-1-yl)cyclohexan-1-ol chloride (PubChem CID 139241411) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-(3-benzylimidazol-3-ium-1-yl)cyclohexan-1-ol chloride.
| Compound Name | 2-(3-benzylimidazol-3-ium-1-yl)cyclohexan-1-ol chloride |
|---|---|
| PubChem CID | 139241411 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(3-benzylimidazol-3-ium-1-yl)cyclohexan-1-ol chloride |
| SMILES | OC1CCCCC1n1cc[n+](Cc2ccccc2)c1.[Cl-] |
| InChI | InChI=1S/C16H21N2O.ClH/c19-16-9-5-4-8-15(16)18-11-10-17(13-18)12-14-6-2-1-3-7-14;/h1-3,6-7,10-11,13,15-16,19H,4-5,8-9,12H2;1H/q+1;/p-1 |
| InChIKey | RLEBWAZNCCEKCR-UHFFFAOYSA-M |
| XLogP | -0.70 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|