C24H27NO — CID 166439187
cis-(1S,2R)-2-(3-benzyl-4-phenylpyrrol-1-yl)cycloheptan-1-ol (PubChem CID 166439187) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is cis-(1S,2R)-2-(3-benzyl-4-phenylpyrrol-1-yl)cycloheptan-1-ol.
| Compound Name | cis-(1S,2R)-2-(3-benzyl-4-phenylpyrrol-1-yl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 166439187 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | cis-(1S,2R)-2-(3-benzyl-4-phenylpyrrol-1-yl)cycloheptan-1-ol |
| SMILES | O[C@H]1CCCCC[C@H]1n1cc(Cc2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H27NO/c26-24-15-9-3-8-14-23(24)25-17-21(16-19-10-4-1-5-11-19)22(18-25)20-12-6-2-7-13-20/h1-2,4-7,10-13,17-18,23-24,26H,3,8-9,14-16H2/t23-,24+/m1/s1 |
| InChIKey | UYTROWCPYPGJKQ-RPWUZVMVSA-N |
| XLogP | 5.61 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |