C13H14O3 — CID 11820670
(1'R,2'R,6'R,7'S)-spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene]-2'-carbaldehyde (PubChem CID 11820670) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (1'R,2'R,6'R,7'S)-spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene]-2'-carbaldehyde.
| Compound Name | (1'R,2'R,6'R,7'S)-spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene]-2'-carbaldehyde |
|---|---|
| PubChem CID | 11820670 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1'R,2'R,6'R,7'S)-spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene]-2'-carbaldehyde |
| SMILES | O=C[C@@]12C=CC3(OCCO3)[C@@H]1[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C13H14O3/c14-8-12-3-4-13(15-5-6-16-13)11(12)9-1-2-10(12)7-9/h1-4,8-11H,5-7H2/t9-,10+,11-,12-/m1/s1 |
| InChIKey | RZXJJDPAYRSQDV-WRWGMCAJSA-N |
| XLogP | 1.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|