C21H29N5O4 — CID 11820838
(E)-1-[4-[2-[1-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]ethoxy]phenyl]-N-ethoxymethanimine (PubChem CID 11820838) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is (E)-1-[4-[2-[1-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]ethoxy]phenyl]-N-ethoxymethanimine.
| Compound Name | (E)-1-[4-[2-[1-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]ethoxy]phenyl]-N-ethoxymethanimine |
|---|---|
| PubChem CID | 11820838 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (E)-1-[4-[2-[1-(4,6-dimethoxy-1,3,5-triazin-2-yl)piperidin-4-yl]ethoxy]phenyl]-N-ethoxymethanimine |
| SMILES | CCO/N=C/c1ccc(OCCC2CCN(c3nc(OC)nc(OC)n3)CC2)cc1 |
| InChI | InChI=1S/C21H29N5O4/c1-4-30-22-15-17-5-7-18(8-6-17)29-14-11-16-9-12-26(13-10-16)19-23-20(27-2)25-21(24-19)28-3/h5-8,15-16H,4,9-14H2,1-3H3/b22-15+ |
| InChIKey | FVZCBFBGCQOCLY-PXLXIMEGSA-N |
| XLogP | 2.94 |
| TPSA | 91.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|