C22H29N3O4S — CID 5273126
ethyl 2-[4-[2-[4-(ethoxyiminomethyl)phenoxy]ethyl]piperidin-1-yl]-1,3-thiazole-4-carboxylate (PubChem CID 5273126) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is ethyl 2-[4-[2-[4-(ethoxyiminomethyl)phenoxy]ethyl]piperidin-1-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[4-[2-[4-(ethoxyiminomethyl)phenoxy]ethyl]piperidin-1-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 5273126 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | ethyl 2-[4-[2-[4-(ethoxyiminomethyl)phenoxy]ethyl]piperidin-1-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCON=Cc1ccc(OCCC2CCN(c3nc(C(=O)OCC)cs3)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O4S/c1-3-27-21(26)20-16-30-22(24-20)25-12-9-17(10-13-25)11-14-28-19-7-5-18(6-8-19)15-23-29-4-2/h5-8,15-17H,3-4,9-14H2,1-2H3 |
| InChIKey | KCRBSPYYGJVEDG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|