C18H23N3O3S — CID 142759915
ethyl 4-[2-[1-(1,3,4-thiadiazol-2-yl)piperidin-4-yl]ethoxy]benzoate (PubChem CID 142759915) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is ethyl 4-[2-[1-(1,3,4-thiadiazol-2-yl)piperidin-4-yl]ethoxy]benzoate.
| Compound Name | ethyl 4-[2-[1-(1,3,4-thiadiazol-2-yl)piperidin-4-yl]ethoxy]benzoate |
|---|---|
| PubChem CID | 142759915 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | ethyl 4-[2-[1-(1,3,4-thiadiazol-2-yl)piperidin-4-yl]ethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCCC2CCN(c3nncs3)CC2)cc1 |
| InChI | InChI=1S/C18H23N3O3S/c1-2-23-17(22)15-3-5-16(6-4-15)24-12-9-14-7-10-21(11-8-14)18-20-19-13-25-18/h3-6,13-14H,2,7-12H2,1H3 |
| InChIKey | JQVYLJVNRGQYBT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |