About ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate
ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate (PubChem CID 67836658) has the molecular formula C23H26N2O3S
and a molecular weight of 410.54 g/mol. Its IUPAC name is ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate.
Molecular Properties
| Compound Name | ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate |
| PubChem CID | 67836658 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCCC2CCN(c3nsc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C23H26N2O3S/c1-2-27-23(26)18-7-9-19(10-8-18)28-16-13-17-11-14-25(15-12-17)22-20-5-3-4-6-21(20)29-24-22/h3-10,17H,2,11-16H2,1H3 |
| InChIKey | NDDWIYXAPYDREF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate?
The IUPAC name of ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate (CID 67836658) is ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate.
What is the SMILES notation for ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate?
The canonical SMILES for ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate is CCOC(=O)c1ccc(OCCC2CCN(c3nsc4ccccc34)CC2)cc1.
What is the InChIKey of ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate?
The InChIKey is NDDWIYXAPYDREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O3S/c1-2-27-23(26)18-7-9-19(10-8-18)28-16-13-17-11-14-25(15-12-17)22-20-5-3-4-6-21(20)29-24-22/h3-10,17H,2,11-16H2,1H3.
What are the key properties of ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate?
ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate has a molecular weight of 410.54 g/mol, XLogP of 5.16, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[2-[1-(1,2-benzothiazol-3-yl)piperidin-4-yl]ethoxy]benzoate is sourced from PubChem (CID 67836658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).