C24H28O7 — CID 18348580
ethyl 4-[2-(2,3-dimethoxy-1,4-dioxo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)ethoxy]benzoate (PubChem CID 18348580) has the molecular formula C24H28O7 and a molecular weight of 428.48 g/mol. Its IUPAC name is ethyl 4-[2-(2,3-dimethoxy-1,4-dioxo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)ethoxy]benzoate.
| Compound Name | ethyl 4-[2-(2,3-dimethoxy-1,4-dioxo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)ethoxy]benzoate |
|---|---|
| PubChem CID | 18348580 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | ethyl 4-[2-(2,3-dimethoxy-1,4-dioxo-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)ethoxy]benzoate |
| SMILES | CCOC(=O)c1ccc(OCCC2CCC3=C(CC2)C(=O)C(OC)=C(OC)C3=O)cc1 |
| InChI | InChI=1S/C24H28O7/c1-4-30-24(27)16-7-9-17(10-8-16)31-14-13-15-5-11-18-19(12-6-15)21(26)23(29-3)22(28-2)20(18)25/h7-10,15H,4-6,11-14H2,1-3H3 |
| InChIKey | XBJRSKQTDDPYMF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|