C29H40ClNO5 — CID 139878158
7-[2-[[(6R)-6-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl]-2,3-dimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione;hydrochloride (PubChem CID 139878158) has the molecular formula C29H40ClNO5 and a molecular weight of 518.09 g/mol. Its IUPAC name is 7-[2-[[(6R)-6-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl]-2,3-dimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione;hydrochloride.
| Compound Name | 7-[2-[[(6R)-6-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl]-2,3-dimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 139878158 |
| Molecular Formula | C29H40ClNO5 |
| Molecular Weight | 518.09 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | 7-[2-[[(6R)-6-[2-(dimethylamino)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl]-2,3-dimethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulene-1,4-dione;hydrochloride |
| SMILES | COC1=C(OC)C(=O)C2=C(CCC(CCOc3ccc4c(c3)CC[C@@H](CCN(C)C)C4)CC2)C1=O.Cl |
| InChI | InChI=1S/C29H39NO5.ClH/c1-30(2)15-13-20-5-8-22-18-23(10-9-21(22)17-20)35-16-14-19-6-11-24-25(12-7-19)27(32)29(34-4)28(33-3)26(24)31;/h9-10,18-20H,5-8,11-17H2,1-4H3;1H/t20-;/m0./s1 |
| InChIKey | IMRLBSRMAFJKFU-BDQAORGHSA-N |
| XLogP | 5.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.09 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|