C28H31NO2 — CID 156789656
2-[6-[(7-methoxy-2-phenyl-6-bicyclo[3.1.1]hepta-1,3,5(7)-trienyl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-N,N-dimethylethanamine (PubChem CID 156789656) has the molecular formula C28H31NO2 and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-[6-[(7-methoxy-2-phenyl-6-bicyclo[3.1.1]hepta-1,3,5(7)-trienyl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[6-[(7-methoxy-2-phenyl-6-bicyclo[3.1.1]hepta-1,3,5(7)-trienyl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 156789656 |
| Molecular Formula | C28H31NO2 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-[6-[(7-methoxy-2-phenyl-6-bicyclo[3.1.1]hepta-1,3,5(7)-trienyl)oxy]-1,2,3,4-tetrahydronaphthalen-2-yl]-N,N-dimethylethanamine |
| SMILES | COC1=C2C=CC(c3ccccc3)=C1C2Oc1ccc2c(c1)CCC(CCN(C)C)C2 |
| InChI | InChI=1S/C28H31NO2/c1-29(2)16-15-19-9-10-22-18-23(12-11-21(22)17-19)31-28-25-14-13-24(26(28)27(25)30-3)20-7-5-4-6-8-20/h4-8,11-14,18-19,28H,9-10,15-17H2,1-3H3 |
| InChIKey | OWUNCBQHIPKEIV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |