C27H32NO2+ — CID 91416199
hydroxy-dimethyl-[2-[6-[(4-phenylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]azanium (PubChem CID 91416199) has the molecular formula C27H32NO2+ and a molecular weight of 402.56 g/mol. Its IUPAC name is hydroxy-dimethyl-[2-[6-[(4-phenylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]azanium.
| Compound Name | hydroxy-dimethyl-[2-[6-[(4-phenylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]azanium |
|---|---|
| PubChem CID | 91416199 |
| Molecular Formula | C27H32NO2+ |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | hydroxy-dimethyl-[2-[6-[(4-phenylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]azanium |
| SMILES | C[N+](C)(O)CCC1CCc2cc(OCc3ccc(-c4ccccc4)cc3)ccc2C1 |
| InChI | InChI=1S/C27H32NO2/c1-28(2,29)17-16-21-8-13-26-19-27(15-14-25(26)18-21)30-20-22-9-11-24(12-10-22)23-6-4-3-5-7-23/h3-7,9-12,14-15,19,21,29H,8,13,16-18,20H2,1-2H3/q+1 |
| InChIKey | XOBUCFABZIUTRD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|