C30H40Cl2N2O — CID 18361575
N,N,N'-trimethyl-N'-[2-[6-[(4-phenylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 18361575) has the molecular formula C30H40Cl2N2O and a molecular weight of 515.57 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[2-[6-[(4-phenylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]ethane-1,2-diamine;dihydrochloride.
| Compound Name | N,N,N'-trimethyl-N'-[2-[6-[(4-phenylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 18361575 |
| Molecular Formula | C30H40Cl2N2O |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | N,N,N'-trimethyl-N'-[2-[6-[(4-phenylphenyl)methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | CN(C)CCN(C)CCC1CCc2cc(OCc3ccc(-c4ccccc4)cc3)ccc2C1.Cl.Cl |
| InChI | InChI=1S/C30H38N2O.2ClH/c1-31(2)19-20-32(3)18-17-24-9-14-29-22-30(16-15-28(29)21-24)33-23-25-10-12-27(13-11-25)26-7-5-4-6-8-26;;/h4-8,10-13,15-16,22,24H,9,14,17-21,23H2,1-3H3;2*1H |
| InChIKey | PLZPHXAJKBELJV-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |