C31H40ClNO4 — CID 18361500
N,N-dimethyl-2-[6-[[4-(2,3,4-trimethoxy-6-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethanamine;hydrochloride (PubChem CID 18361500) has the molecular formula C31H40ClNO4 and a molecular weight of 526.12 g/mol. Its IUPAC name is N,N-dimethyl-2-[6-[[4-(2,3,4-trimethoxy-6-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethanamine;hydrochloride.
| Compound Name | N,N-dimethyl-2-[6-[[4-(2,3,4-trimethoxy-6-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 18361500 |
| Molecular Formula | C31H40ClNO4 |
| Molecular Weight | 526.12 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | N,N-dimethyl-2-[6-[[4-(2,3,4-trimethoxy-6-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]ethanamine;hydrochloride |
| SMILES | COc1cc(C)c(-c2ccc(COc3ccc4c(c3)CCC(CCN(C)C)C4)cc2)c(OC)c1OC.Cl |
| InChI | InChI=1S/C31H39NO4.ClH/c1-21-17-28(33-4)30(34-5)31(35-6)29(21)24-10-8-23(9-11-24)20-36-27-14-13-25-18-22(15-16-32(2)3)7-12-26(25)19-27;/h8-11,13-14,17,19,22H,7,12,15-16,18,20H2,1-6H3;1H |
| InChIKey | PTZWQLSYDNYWLO-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.12 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |