C11H12ClN3OS — CID 11820948
prop-2-enyl N'-[(4-chlorobenzoyl)amino]carbamimidothioate (PubChem CID 11820948) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is prop-2-enyl N'-[(4-chlorobenzoyl)amino]carbamimidothioate.
| Compound Name | prop-2-enyl N'-[(4-chlorobenzoyl)amino]carbamimidothioate |
|---|---|
| PubChem CID | 11820948 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | prop-2-enyl N'-[(4-chlorobenzoyl)amino]carbamimidothioate |
| SMILES | C=CCS/C(N)=N/NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H12ClN3OS/c1-2-7-17-11(13)15-14-10(16)8-3-5-9(12)6-4-8/h2-6H,1,7H2,(H2,13,15)(H,14,16) |
| InChIKey | FRJUSVJCYHUKBZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|