C38H32N6O3 — CID 118210669
2-[(N-methylanilino)methyl]-3H-benzo[e]benzimidazole-4,5-dione;2-[(N-methylanilino)methyl]-3H-benzo[e]benzimidazol-5-ol (PubChem CID 118210669) has the molecular formula C38H32N6O3 and a molecular weight of 620.71 g/mol. Its IUPAC name is 2-[(N-methylanilino)methyl]-3H-benzo[e]benzimidazole-4,5-dione;2-[(N-methylanilino)methyl]-3H-benzo[e]benzimidazol-5-ol.
| Compound Name | 2-[(N-methylanilino)methyl]-3H-benzo[e]benzimidazole-4,5-dione;2-[(N-methylanilino)methyl]-3H-benzo[e]benzimidazol-5-ol |
|---|---|
| PubChem CID | 118210669 |
| Molecular Formula | C38H32N6O3 |
| Molecular Weight | 620.71 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | 2-[(N-methylanilino)methyl]-3H-benzo[e]benzimidazole-4,5-dione;2-[(N-methylanilino)methyl]-3H-benzo[e]benzimidazol-5-ol |
| SMILES | CN(Cc1nc2c([nH]1)C(=O)C(=O)c1ccccc1-2)c1ccccc1.CN(Cc1nc2c(cc(O)c3ccccc32)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C19H15N3O2.C19H17N3O/c1-22(12-7-3-2-4-8-12)11-15-20-16-13-9-5-6-10-14(13)18(23)19(24)17(16)21-15;1-22(13-7-3-2-4-8-13)12-18-20-16-11-17(23)14-9-5-6-10-15(14)19(16)21-18/h2-10H,11H2,1H3,(H,20,21);2-11,23H,12H2,1H3,(H,20,21) |
| InChIKey | MKGKKAOKKIRLKP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|